Decarbonylation reaction of $[cis-(CH_3CO)Mn(^{13}CO)(CO)_4]$ yields X,Y and Z, where $X =[(CH_3)Mn(CO)_5]$; $Y = [cis-(CH_3)Mn(^{13}CO)(CO)_4]$; $Z = [trans-(CH_3)Mn(^{13}CO)(CO)_4]$ The molar ratio of the products(X : Y : Z) in this reaction is
1:2:1
The question asks for the product molar ratio of the decarbonylation reaction of cis-(CH3CO)Mn(13CO)(CO)4. This reaction involves the loss of a carbonyl (CO) ligand and the migration of the acetyl group (CH3CO) to the manganese metal center, eventually forming a methyl group (CH3) attached to Mn.
The key is to determine which CO ligand is lost and how the position of the lost ligand influences the formation of the specific products (X, Y, Z) and their stereochemistry.
We assume a trigonal bipyramidal (TBP) structure for the manganese complex, which is common. Let the equatorial positions be denoted $eq_A, eq_B, eq_C$ and axial positions $ax_1, ax_2$. The starting complex is given as cis-(CH3CO)Mn(13CO)(CO)4. This implies:
The reaction produces three products:
The molar ratio of products X:Y:Z depends on the relative probabilities of losing a CO ligand from different positions.
Based on typical reactivity patterns in TBP complexes, equatorial positions are often more reactive than axial positions. The observed ratio 1:2:1 suggests the following relative probabilities:
This implies that equatorial CO ligands are collectively more likely to be lost than axial ones, and specifically, the loss of a regular equatorial CO (leading to Y) is twice as likely as the loss of the labeled equatorial 13CO (leading to X) or the loss of an axial CO (leading to Z).
Therefore, the molar ratio X : Y : Z is 1 : 2 : 1.
The reaction that proceeds through an oxidative addition followed by a reductive elimination is
[Given: Atomic numbers Ni = 28, Ta = 73, Zr = 40, Pt = 78]
The heptacity of allyl and Cp and the ligation mode of NO in the thermodynamically stable complexes
$[(\eta^x-allyl)Ru(CO)_2(NO)]$ and $[(\eta^y-Cp)Ru(CO)_2(NO)]$,
respectively, are
(The heptacity of allyl and Cp are denoted by $\eta^x$ and $\eta^y$, respectively.)
The hapticity of cycloheptatriene, $(C_7H_8)$, in $Mo(C_7H_8)(CO)_3$ is ______________.
The bond angle (Ti-C-C) in the crystal structure of
is severely distorted due to
The major product of the following reaction sequence is
